C12H12BrN5O2S — CID 16682277
3-ethyl-6-(3-nitrophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine;hydrobromide (PubChem CID 16682277) has the molecular formula C12H12BrN5O2S and a molecular weight of 370.23 g/mol. Its IUPAC name is 3-ethyl-6-(3-nitrophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine;hydrobromide.
| Compound Name | 3-ethyl-6-(3-nitrophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine;hydrobromide |
|---|---|
| PubChem CID | 16682277 |
| Molecular Formula | C12H12BrN5O2S |
| Molecular Weight | 370.23 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | 3-ethyl-6-(3-nitrophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine;hydrobromide |
| SMILES | Br.CCc1nnc2n1N=C(c1cccc([N+](=O)[O-])c1)CS2 |
| InChI | InChI=1S/C12H11N5O2S.BrH/c1-2-11-13-14-12-16(11)15-10(7-20-12)8-4-3-5-9(6-8)17(18)19;/h3-6H,2,7H2,1H3;1H |
| InChIKey | LFZSGIVWOLTRKV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 86.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.23 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|