C14H15BrCl2N4S — CID 45135371
3-butyl-6-(3,4-dichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine;hydrobromide (PubChem CID 45135371) has the molecular formula C14H15BrCl2N4S and a molecular weight of 422.18 g/mol. Its IUPAC name is 3-butyl-6-(3,4-dichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine;hydrobromide.
| Compound Name | 3-butyl-6-(3,4-dichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine;hydrobromide |
|---|---|
| PubChem CID | 45135371 |
| Molecular Formula | C14H15BrCl2N4S |
| Molecular Weight | 422.18 g/mol |
| Exact Mass | 419.96 |
| IUPAC Name | 3-butyl-6-(3,4-dichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine;hydrobromide |
| SMILES | Br.CCCCc1nnc2n1N=C(c1ccc(Cl)c(Cl)c1)CS2 |
| InChI | InChI=1S/C14H14Cl2N4S.BrH/c1-2-3-4-13-17-18-14-20(13)19-12(8-21-14)9-5-6-10(15)11(16)7-9;/h5-7H,2-4,8H2,1H3;1H |
| InChIKey | MQSGGLZDXAWKKC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.18 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |