C11H6BrF3N5O2S- — CID 21176904
6-(3-nitrophenyl)-3-(trifluoromethyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine bromide (PubChem CID 21176904) has the molecular formula C11H6BrF3N5O2S- and a molecular weight of 409.17 g/mol. Its IUPAC name is 6-(3-nitrophenyl)-3-(trifluoromethyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine bromide.
| Compound Name | 6-(3-nitrophenyl)-3-(trifluoromethyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine bromide |
|---|---|
| PubChem CID | 21176904 |
| Molecular Formula | C11H6BrF3N5O2S- |
| Molecular Weight | 409.17 g/mol |
| Exact Mass | 407.94 |
| IUPAC Name | 6-(3-nitrophenyl)-3-(trifluoromethyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine bromide |
| SMILES | O=[N+]([O-])c1cccc(C2=Nn3c(nnc3C(F)(F)F)SC2)c1.[Br-] |
| InChI | InChI=1S/C11H6F3N5O2S.BrH/c12-11(13,14)9-15-16-10-18(9)17-8(5-22-10)6-2-1-3-7(4-6)19(20)21;/h1-4H,5H2;1H/p-1 |
| InChIKey | FBRJLXNQOAUDDP-UHFFFAOYSA-M |
| XLogP | -0.43 |
| TPSA | 86.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.17 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|