C19H21ClN4O2S2 — CID 135883729
5-(1-ethylsulfonyl-2,3-dihydroindol-5-yl)-N-phenyl-3,6-dihydro-1,3,4-thiadiazin-2-imine;hydrochloride (PubChem CID 135883729) has the molecular formula C19H21ClN4O2S2 and a molecular weight of 436.99 g/mol. Its IUPAC name is 5-(1-ethylsulfonyl-2,3-dihydroindol-5-yl)-N-phenyl-3,6-dihydro-1,3,4-thiadiazin-2-imine;hydrochloride.
| Compound Name | 5-(1-ethylsulfonyl-2,3-dihydroindol-5-yl)-N-phenyl-3,6-dihydro-1,3,4-thiadiazin-2-imine;hydrochloride |
|---|---|
| PubChem CID | 135883729 |
| Molecular Formula | C19H21ClN4O2S2 |
| Molecular Weight | 436.99 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | 5-(1-ethylsulfonyl-2,3-dihydroindol-5-yl)-N-phenyl-3,6-dihydro-1,3,4-thiadiazin-2-imine;hydrochloride |
| SMILES | CCS(=O)(=O)N1CCc2cc(C3=NN/C(=N/c4ccccc4)SC3)ccc21.Cl |
| InChI | InChI=1S/C19H20N4O2S2.ClH/c1-2-27(24,25)23-11-10-15-12-14(8-9-18(15)23)17-13-26-19(22-21-17)20-16-6-4-3-5-7-16;/h3-9,12H,2,10-11,13H2,1H3,(H,20,22);1H |
| InChIKey | JHRIVABPUUMIHS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.99 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|