C20H20N4O2S — CID 135840312
1-[4-[2-(2-methoxyphenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]pyrrolidin-2-one (PubChem CID 135840312) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is 1-[4-[2-(2-methoxyphenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]pyrrolidin-2-one.
| Compound Name | 1-[4-[2-(2-methoxyphenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 135840312 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 1-[4-[2-(2-methoxyphenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]pyrrolidin-2-one |
| SMILES | COc1ccccc1/N=C1/NN=C(c2ccc(N3CCCC3=O)cc2)CS1 |
| InChI | InChI=1S/C20H20N4O2S/c1-26-18-6-3-2-5-16(18)21-20-23-22-17(13-27-20)14-8-10-15(11-9-14)24-12-4-7-19(24)25/h2-3,5-6,8-11H,4,7,12-13H2,1H3,(H,21,23) |
| InChIKey | NRUYWWGPUKWURN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|