C21H23N3O4S — CID 19358046
N-[4-[2-[5-(3,4-dimethoxyphenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]ethyl]phenyl]acetamide (PubChem CID 19358046) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is N-[4-[2-[5-(3,4-dimethoxyphenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]ethyl]phenyl]acetamide.
| Compound Name | N-[4-[2-[5-(3,4-dimethoxyphenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]ethyl]phenyl]acetamide |
|---|---|
| PubChem CID | 19358046 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-[4-[2-[5-(3,4-dimethoxyphenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]ethyl]phenyl]acetamide |
| SMILES | COc1ccc(C2=NN(CCc3ccc(NC(C)=O)cc3)C(=O)SC2)cc1OC |
| InChI | InChI=1S/C21H23N3O4S/c1-14(25)22-17-7-4-15(5-8-17)10-11-24-21(26)29-13-18(23-24)16-6-9-19(27-2)20(12-16)28-3/h4-9,12H,10-11,13H2,1-3H3,(H,22,25) |
| InChIKey | PYZYAURWIGOZEB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|