C23H28N4O4S — CID 91329491
N-[4-[[5-(3,4-dimethoxyphenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]-3-(dimethylamino)propanamide (PubChem CID 91329491) has the molecular formula C23H28N4O4S and a molecular weight of 456.57 g/mol. Its IUPAC name is N-[4-[[5-(3,4-dimethoxyphenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]-3-(dimethylamino)propanamide.
| Compound Name | N-[4-[[5-(3,4-dimethoxyphenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]-3-(dimethylamino)propanamide |
|---|---|
| PubChem CID | 91329491 |
| Molecular Formula | C23H28N4O4S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-[4-[[5-(3,4-dimethoxyphenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]-3-(dimethylamino)propanamide |
| SMILES | COc1ccc(C2=NN(Cc3ccc(NC(=O)CCN(C)C)cc3)C(=O)SC2)cc1OC |
| InChI | InChI=1S/C23H28N4O4S/c1-26(2)12-11-22(28)24-18-8-5-16(6-9-18)14-27-23(29)32-15-19(25-27)17-7-10-20(30-3)21(13-17)31-4/h5-10,13H,11-12,14-15H2,1-4H3,(H,24,28) |
| InChIKey | KNHFKFQTEQGKLN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|