C27H34N4O4S — CID 174461827
2-[1-[4-[[5-(4-methoxy-3-propan-2-yloxyphenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]pyrrolidin-3-yl]propanamide (PubChem CID 174461827) has the molecular formula C27H34N4O4S and a molecular weight of 510.66 g/mol. Its IUPAC name is 2-[1-[4-[[5-(4-methoxy-3-propan-2-yloxyphenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]pyrrolidin-3-yl]propanamide.
| Compound Name | 2-[1-[4-[[5-(4-methoxy-3-propan-2-yloxyphenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]pyrrolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 174461827 |
| Molecular Formula | C27H34N4O4S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | 2-[1-[4-[[5-(4-methoxy-3-propan-2-yloxyphenyl)-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]phenyl]pyrrolidin-3-yl]propanamide |
| SMILES | COc1ccc(C2=NN(Cc3ccc(N4CCC(C(C)C(N)=O)C4)cc3)C(=O)SC2)cc1OC(C)C |
| InChI | InChI=1S/C27H34N4O4S/c1-17(2)35-25-13-20(7-10-24(25)34-4)23-16-36-27(33)31(29-23)14-19-5-8-22(9-6-19)30-12-11-21(15-30)18(3)26(28)32/h5-10,13,17-18,21H,11-12,14-16H2,1-4H3,(H2,28,32) |
| InChIKey | MHHKBDFTNRHUGS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|