C24H29N3O3S2 — CID 174461778
5-(4-methoxy-3-propan-2-yloxyphenyl)-3-[(4-thiomorpholin-4-ylphenyl)methyl]-6H-1,3,4-thiadiazin-2-one (PubChem CID 174461778) has the molecular formula C24H29N3O3S2 and a molecular weight of 471.65 g/mol. Its IUPAC name is 5-(4-methoxy-3-propan-2-yloxyphenyl)-3-[(4-thiomorpholin-4-ylphenyl)methyl]-6H-1,3,4-thiadiazin-2-one.
| Compound Name | 5-(4-methoxy-3-propan-2-yloxyphenyl)-3-[(4-thiomorpholin-4-ylphenyl)methyl]-6H-1,3,4-thiadiazin-2-one |
|---|---|
| PubChem CID | 174461778 |
| Molecular Formula | C24H29N3O3S2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 5-(4-methoxy-3-propan-2-yloxyphenyl)-3-[(4-thiomorpholin-4-ylphenyl)methyl]-6H-1,3,4-thiadiazin-2-one |
| SMILES | COc1ccc(C2=NN(Cc3ccc(N4CCSCC4)cc3)C(=O)SC2)cc1OC(C)C |
| InChI | InChI=1S/C24H29N3O3S2/c1-17(2)30-23-14-19(6-9-22(23)29-3)21-16-32-24(28)27(25-21)15-18-4-7-20(8-5-18)26-10-12-31-13-11-26/h4-9,14,17H,10-13,15-16H2,1-3H3 |
| InChIKey | CKCFEJBUCDLAHO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|