C21H22N2O5S — CID 19358156
4-[[5-(3,4-dimethoxyphenyl)-6-ethyl-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]benzoic acid (PubChem CID 19358156) has the molecular formula C21H22N2O5S and a molecular weight of 414.48 g/mol. Its IUPAC name is 4-[[5-(3,4-dimethoxyphenyl)-6-ethyl-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]benzoic acid.
| Compound Name | 4-[[5-(3,4-dimethoxyphenyl)-6-ethyl-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 19358156 |
| Molecular Formula | C21H22N2O5S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 4-[[5-(3,4-dimethoxyphenyl)-6-ethyl-2-oxo-6H-1,3,4-thiadiazin-3-yl]methyl]benzoic acid |
| SMILES | CCC1SC(=O)N(Cc2ccc(C(=O)O)cc2)N=C1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H22N2O5S/c1-4-18-19(15-9-10-16(27-2)17(11-15)28-3)22-23(21(26)29-18)12-13-5-7-14(8-6-13)20(24)25/h5-11,18H,4,12H2,1-3H3,(H,24,25) |
| InChIKey | BHPODPDGABBIFX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|