C24H24N2O5 — CID 54057514
4-[[4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,8,8a-tetrahydrophthalazin-2-yl]methyl]benzoic acid (PubChem CID 54057514) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is 4-[[4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,8,8a-tetrahydrophthalazin-2-yl]methyl]benzoic acid.
| Compound Name | 4-[[4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,8,8a-tetrahydrophthalazin-2-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 54057514 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 4-[[4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,8,8a-tetrahydrophthalazin-2-yl]methyl]benzoic acid |
| SMILES | COc1ccc(C2=NN(Cc3ccc(C(=O)O)cc3)C(=O)C3CC=CCC23)cc1OC |
| InChI | InChI=1S/C24H24N2O5/c1-30-20-12-11-17(13-21(20)31-2)22-18-5-3-4-6-19(18)23(27)26(25-22)14-15-7-9-16(10-8-15)24(28)29/h3-4,7-13,18-19H,5-6,14H2,1-2H3,(H,28,29) |
| InChIKey | LXHMNCNZZKEPOX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|