C24H25BrN2O3 — CID 68923703
2-[[3-(bromomethyl)phenyl]methyl]-4-(3,4-dimethoxyphenyl)-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 68923703) has the molecular formula C24H25BrN2O3 and a molecular weight of 469.38 g/mol. Its IUPAC name is 2-[[3-(bromomethyl)phenyl]methyl]-4-(3,4-dimethoxyphenyl)-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | 2-[[3-(bromomethyl)phenyl]methyl]-4-(3,4-dimethoxyphenyl)-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 68923703 |
| Molecular Formula | C24H25BrN2O3 |
| Molecular Weight | 469.38 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | 2-[[3-(bromomethyl)phenyl]methyl]-4-(3,4-dimethoxyphenyl)-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | COc1ccc(C2=NN(Cc3cccc(CBr)c3)C(=O)C3CC=CCC23)cc1OC |
| InChI | InChI=1S/C24H25BrN2O3/c1-29-21-11-10-18(13-22(21)30-2)23-19-8-3-4-9-20(19)24(28)27(26-23)15-17-7-5-6-16(12-17)14-25/h3-7,10-13,19-20H,8-9,14-15H2,1-2H3 |
| InChIKey | NXEAQMAUJPIIDW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.38 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|