C25H33ClN4O3 — CID 86755627
(4aR,8aS)-4-(3,4-dimethoxyphenyl)-2-(6-imidazol-1-ylhexyl)-4a,5,8,8a-tetrahydrophthalazin-1-one;hydrochloride (PubChem CID 86755627) has the molecular formula C25H33ClN4O3 and a molecular weight of 473.02 g/mol. Its IUPAC name is (4aR,8aS)-4-(3,4-dimethoxyphenyl)-2-(6-imidazol-1-ylhexyl)-4a,5,8,8a-tetrahydrophthalazin-1-one;hydrochloride.
| Compound Name | (4aR,8aS)-4-(3,4-dimethoxyphenyl)-2-(6-imidazol-1-ylhexyl)-4a,5,8,8a-tetrahydrophthalazin-1-one;hydrochloride |
|---|---|
| PubChem CID | 86755627 |
| Molecular Formula | C25H33ClN4O3 |
| Molecular Weight | 473.02 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | (4aR,8aS)-4-(3,4-dimethoxyphenyl)-2-(6-imidazol-1-ylhexyl)-4a,5,8,8a-tetrahydrophthalazin-1-one;hydrochloride |
| SMILES | COc1ccc(C2=NN(CCCCCCn3ccnc3)C(=O)[C@H]3CC=CC[C@@H]23)cc1OC.Cl |
| InChI | InChI=1S/C25H32N4O3.ClH/c1-31-22-12-11-19(17-23(22)32-2)24-20-9-5-6-10-21(20)25(30)29(27-24)15-8-4-3-7-14-28-16-13-26-18-28;/h5-6,11-13,16-18,20-21H,3-4,7-10,14-15H2,1-2H3;1H/t20-,21+;/m1./s1 |
| InChIKey | VJMHURRAKIKQGN-BHDTVMLSSA-N |
| XLogP | 4.71 |
| TPSA | 68.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.02 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|