C25H38ClN3O3 — CID 70001882
(4aS,8aR)-4-(3,4-dimethoxyphenyl)-2-(4-piperidin-1-ylbutyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride (PubChem CID 70001882) has the molecular formula C25H38ClN3O3 and a molecular weight of 464.05 g/mol. Its IUPAC name is (4aS,8aR)-4-(3,4-dimethoxyphenyl)-2-(4-piperidin-1-ylbutyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride.
| Compound Name | (4aS,8aR)-4-(3,4-dimethoxyphenyl)-2-(4-piperidin-1-ylbutyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride |
|---|---|
| PubChem CID | 70001882 |
| Molecular Formula | C25H38ClN3O3 |
| Molecular Weight | 464.05 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | (4aS,8aR)-4-(3,4-dimethoxyphenyl)-2-(4-piperidin-1-ylbutyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride |
| SMILES | COc1ccc(C2=NN(CCCCN3CCCCC3)C(=O)[C@@H]3CCCC[C@H]23)cc1OC.Cl |
| InChI | InChI=1S/C25H37N3O3.ClH/c1-30-22-13-12-19(18-23(22)31-2)24-20-10-4-5-11-21(20)25(29)28(26-24)17-9-8-16-27-14-6-3-7-15-27;/h12-13,18,20-21H,3-11,14-17H2,1-2H3;1H/t20-,21+;/m0./s1 |
| InChIKey | WGQISCZTVWMDBS-JUDYQFGCSA-N |
| XLogP | 4.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.05 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|