C24H26N2O5 — CID 11058928
4-[[4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]methyl]benzoic acid (PubChem CID 11058928) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is 4-[[4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]methyl]benzoic acid.
| Compound Name | 4-[[4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 11058928 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 4-[[4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]methyl]benzoic acid |
| SMILES | COc1ccc(C2=NN(Cc3ccc(C(=O)O)cc3)C(=O)C3CCCCC23)cc1OC |
| InChI | InChI=1S/C24H26N2O5/c1-30-20-12-11-17(13-21(20)31-2)22-18-5-3-4-6-19(18)23(27)26(25-22)14-15-7-9-16(10-8-15)24(28)29/h7-13,18-19H,3-6,14H2,1-2H3,(H,28,29) |
| InChIKey | PVWGPCPZYAEPPN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |