C25H28N2O5 — CID 10939029
methyl 4-[[4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]methyl]benzoate (PubChem CID 10939029) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is methyl 4-[[4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]methyl]benzoate.
| Compound Name | methyl 4-[[4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]methyl]benzoate |
|---|---|
| PubChem CID | 10939029 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | methyl 4-[[4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2N=C(c3ccc(OC)c(OC)c3)C3CCCCC3C2=O)cc1 |
| InChI | InChI=1S/C25H28N2O5/c1-30-21-13-12-18(14-22(21)31-2)23-19-6-4-5-7-20(19)24(28)27(26-23)15-16-8-10-17(11-9-16)25(29)32-3/h8-14,19-20H,4-7,15H2,1-3H3 |
| InChIKey | KPHBKZYONHHTQY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |