C22H33N3O3 — CID 86755606
(4aR,8aS)-4-(3,4-dimethoxyphenyl)-2-[4-(dimethylamino)butyl]-4a,5,6,7,8,8a-hexahydrophthalazin-1-one (PubChem CID 86755606) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is (4aR,8aS)-4-(3,4-dimethoxyphenyl)-2-[4-(dimethylamino)butyl]-4a,5,6,7,8,8a-hexahydrophthalazin-1-one.
| Compound Name | (4aR,8aS)-4-(3,4-dimethoxyphenyl)-2-[4-(dimethylamino)butyl]-4a,5,6,7,8,8a-hexahydrophthalazin-1-one |
|---|---|
| PubChem CID | 86755606 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | (4aR,8aS)-4-(3,4-dimethoxyphenyl)-2-[4-(dimethylamino)butyl]-4a,5,6,7,8,8a-hexahydrophthalazin-1-one |
| SMILES | COc1ccc(C2=NN(CCCCN(C)C)C(=O)[C@H]3CCCC[C@@H]23)cc1OC |
| InChI | InChI=1S/C22H33N3O3/c1-24(2)13-7-8-14-25-22(26)18-10-6-5-9-17(18)21(23-25)16-11-12-19(27-3)20(15-16)28-4/h11-12,15,17-18H,5-10,13-14H2,1-4H3/t17-,18+/m1/s1 |
| InChIKey | ZFPQQBRXDLRJDH-MSOLQXFVSA-N |
| XLogP | 3.40 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|