C18H24BrClN2O3 — CID 18690918
2-(2-bromoethyl)-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride (PubChem CID 18690918) has the molecular formula C18H24BrClN2O3 and a molecular weight of 431.76 g/mol. Its IUPAC name is 2-(2-bromoethyl)-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride.
| Compound Name | 2-(2-bromoethyl)-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride |
|---|---|
| PubChem CID | 18690918 |
| Molecular Formula | C18H24BrClN2O3 |
| Molecular Weight | 431.76 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 2-(2-bromoethyl)-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride |
| SMILES | COc1ccc(C2=NN(CCBr)C(=O)C3CCCCC23)cc1OC.Cl |
| InChI | InChI=1S/C18H23BrN2O3.ClH/c1-23-15-8-7-12(11-16(15)24-2)17-13-5-3-4-6-14(13)18(22)21(20-17)10-9-19;/h7-8,11,13-14H,3-6,9-10H2,1-2H3;1H |
| InChIKey | ZXLQZGJWFZNATH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.76 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|