C33H43N3O5 — CID 11577691
4-(3,4-dimethoxyphenyl)-2-[5-[[5-(4-methoxyphenyl)oxolan-2-yl]methylamino]pentyl]-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 11577691) has the molecular formula C33H43N3O5 and a molecular weight of 561.72 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-2-[5-[[5-(4-methoxyphenyl)oxolan-2-yl]methylamino]pentyl]-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | 4-(3,4-dimethoxyphenyl)-2-[5-[[5-(4-methoxyphenyl)oxolan-2-yl]methylamino]pentyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 11577691 |
| Molecular Formula | C33H43N3O5 |
| Molecular Weight | 561.72 g/mol |
| Exact Mass | 561.32 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-2-[5-[[5-(4-methoxyphenyl)oxolan-2-yl]methylamino]pentyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | COc1ccc(C2CCC(CNCCCCCN3N=C(c4ccc(OC)c(OC)c4)C4CC=CCC4C3=O)O2)cc1 |
| InChI | InChI=1S/C33H43N3O5/c1-38-25-14-11-23(12-15-25)29-18-16-26(41-29)22-34-19-7-4-8-20-36-33(37)28-10-6-5-9-27(28)32(35-36)24-13-17-30(39-2)31(21-24)40-3/h5-6,11-15,17,21,26-29,34H,4,7-10,16,18-20,22H2,1-3H3 |
| InChIKey | XFZXYKNTJNZMJW-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.72 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|