C29H34ClN5O4 — CID 22337180
2-amino-3-chloro-5-[2-[4-[4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,8,8a-tetrahydrophthalazin-2-yl]butylamino]-1-hydroxyethyl]benzonitrile (PubChem CID 22337180) has the molecular formula C29H34ClN5O4 and a molecular weight of 552.08 g/mol. Its IUPAC name is 2-amino-3-chloro-5-[2-[4-[4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,8,8a-tetrahydrophthalazin-2-yl]butylamino]-1-hydroxyethyl]benzonitrile.
| Compound Name | 2-amino-3-chloro-5-[2-[4-[4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,8,8a-tetrahydrophthalazin-2-yl]butylamino]-1-hydroxyethyl]benzonitrile |
|---|---|
| PubChem CID | 22337180 |
| Molecular Formula | C29H34ClN5O4 |
| Molecular Weight | 552.08 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | 2-amino-3-chloro-5-[2-[4-[4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,8,8a-tetrahydrophthalazin-2-yl]butylamino]-1-hydroxyethyl]benzonitrile |
| SMILES | COc1ccc(C2=NN(CCCCNCC(O)c3cc(Cl)c(N)c(C#N)c3)C(=O)C3CC=CCC23)cc1OC |
| InChI | InChI=1S/C29H34ClN5O4/c1-38-25-10-9-18(15-26(25)39-2)28-21-7-3-4-8-22(21)29(37)35(34-28)12-6-5-11-33-17-24(36)19-13-20(16-31)27(32)23(30)14-19/h3-4,9-10,13-15,21-22,24,33,36H,5-8,11-12,17,32H2,1-2H3 |
| InChIKey | GIFOVFQICNYFIR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.08 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|