C23H23IN2O3 — CID 68916488
(4aR,8aS)-4-(3,4-dimethoxyphenyl)-2-[(4-iodophenyl)methyl]-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 68916488) has the molecular formula C23H23IN2O3 and a molecular weight of 502.35 g/mol. Its IUPAC name is (4aR,8aS)-4-(3,4-dimethoxyphenyl)-2-[(4-iodophenyl)methyl]-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | (4aR,8aS)-4-(3,4-dimethoxyphenyl)-2-[(4-iodophenyl)methyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 68916488 |
| Molecular Formula | C23H23IN2O3 |
| Molecular Weight | 502.35 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | (4aR,8aS)-4-(3,4-dimethoxyphenyl)-2-[(4-iodophenyl)methyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | COc1ccc(C2=NN(Cc3ccc(I)cc3)C(=O)[C@H]3CC=CC[C@@H]23)cc1OC |
| InChI | InChI=1S/C23H23IN2O3/c1-28-20-12-9-16(13-21(20)29-2)22-18-5-3-4-6-19(18)23(27)26(25-22)14-15-7-10-17(24)11-8-15/h3-4,7-13,18-19H,5-6,14H2,1-2H3/t18-,19+/m1/s1 |
| InChIKey | MNQCSVQHWCMOMD-MOPGFXCFSA-N |
| XLogP | 4.64 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|