C28H31BrN2O3 — CID 68921229
(4aS,8aR)-2-[[4-(bromomethyl)phenyl]methyl]-4-(3-cyclopentyloxy-4-methoxyphenyl)-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 68921229) has the molecular formula C28H31BrN2O3 and a molecular weight of 523.47 g/mol. Its IUPAC name is (4aS,8aR)-2-[[4-(bromomethyl)phenyl]methyl]-4-(3-cyclopentyloxy-4-methoxyphenyl)-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | (4aS,8aR)-2-[[4-(bromomethyl)phenyl]methyl]-4-(3-cyclopentyloxy-4-methoxyphenyl)-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 68921229 |
| Molecular Formula | C28H31BrN2O3 |
| Molecular Weight | 523.47 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | (4aS,8aR)-2-[[4-(bromomethyl)phenyl]methyl]-4-(3-cyclopentyloxy-4-methoxyphenyl)-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | COc1ccc(C2=NN(Cc3ccc(CBr)cc3)C(=O)[C@@H]3CC=CC[C@H]23)cc1OC1CCCC1 |
| InChI | InChI=1S/C28H31BrN2O3/c1-33-25-15-14-21(16-26(25)34-22-6-2-3-7-22)27-23-8-4-5-9-24(23)28(32)31(30-27)18-20-12-10-19(17-29)11-13-20/h4-5,10-16,22-24H,2-3,6-9,17-18H2,1H3/t23-,24+/m0/s1 |
| InChIKey | QFIZJHOVPNKSFY-BJKOFHAPSA-N |
| XLogP | 6.24 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.47 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|