C22H19ClN2O4 — CID 18436683
4-[4-(3-chloro-4-methoxyphenyl)-1-oxo-4a,5,8,8a-tetrahydrophthalazin-2-yl]benzoic acid (PubChem CID 18436683) has the molecular formula C22H19ClN2O4 and a molecular weight of 410.86 g/mol. Its IUPAC name is 4-[4-(3-chloro-4-methoxyphenyl)-1-oxo-4a,5,8,8a-tetrahydrophthalazin-2-yl]benzoic acid.
| Compound Name | 4-[4-(3-chloro-4-methoxyphenyl)-1-oxo-4a,5,8,8a-tetrahydrophthalazin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 18436683 |
| Molecular Formula | C22H19ClN2O4 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 4-[4-(3-chloro-4-methoxyphenyl)-1-oxo-4a,5,8,8a-tetrahydrophthalazin-2-yl]benzoic acid |
| SMILES | COc1ccc(C2=NN(c3ccc(C(=O)O)cc3)C(=O)C3CC=CCC23)cc1Cl |
| InChI | InChI=1S/C22H19ClN2O4/c1-29-19-11-8-14(12-18(19)23)20-16-4-2-3-5-17(16)21(26)25(24-20)15-9-6-13(7-10-15)22(27)28/h2-3,6-12,16-17H,4-5H2,1H3,(H,27,28) |
| InChIKey | WKLKSQPDIITJAK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|