C22H21ClN2O2 — CID 69489772
4-(3-chloro-4-ethoxyphenyl)-2-phenyl-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 69489772) has the molecular formula C22H21ClN2O2 and a molecular weight of 380.88 g/mol. Its IUPAC name is 4-(3-chloro-4-ethoxyphenyl)-2-phenyl-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | 4-(3-chloro-4-ethoxyphenyl)-2-phenyl-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 69489772 |
| Molecular Formula | C22H21ClN2O2 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 4-(3-chloro-4-ethoxyphenyl)-2-phenyl-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | CCOc1ccc(C2=NN(c3ccccc3)C(=O)C3CC=CCC23)cc1Cl |
| InChI | InChI=1S/C22H21ClN2O2/c1-2-27-20-13-12-15(14-19(20)23)21-17-10-6-7-11-18(17)22(26)25(24-21)16-8-4-3-5-9-16/h3-9,12-14,17-18H,2,10-11H2,1H3 |
| InChIKey | OUKXFRRIGMEYDR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|