C21H17ClN4O2S2 — CID 69487090
(4aS,8aR)-4-(3-chloro-4-methoxyphenyl)-2-(3-thiophen-2-yl-1,2,4-thiadiazol-5-yl)-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 69487090) has the molecular formula C21H17ClN4O2S2 and a molecular weight of 456.98 g/mol. Its IUPAC name is (4aS,8aR)-4-(3-chloro-4-methoxyphenyl)-2-(3-thiophen-2-yl-1,2,4-thiadiazol-5-yl)-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | (4aS,8aR)-4-(3-chloro-4-methoxyphenyl)-2-(3-thiophen-2-yl-1,2,4-thiadiazol-5-yl)-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 69487090 |
| Molecular Formula | C21H17ClN4O2S2 |
| Molecular Weight | 456.98 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | (4aS,8aR)-4-(3-chloro-4-methoxyphenyl)-2-(3-thiophen-2-yl-1,2,4-thiadiazol-5-yl)-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | COc1ccc(C2=NN(c3nc(-c4cccs4)ns3)C(=O)[C@@H]3CC=CC[C@H]23)cc1Cl |
| InChI | InChI=1S/C21H17ClN4O2S2/c1-28-16-9-8-12(11-15(16)22)18-13-5-2-3-6-14(13)20(27)26(24-18)21-23-19(25-30-21)17-7-4-10-29-17/h2-4,7-11,13-14H,5-6H2,1H3/t13-,14+/m0/s1 |
| InChIKey | LMKVPAUGSCDEIT-UONOGXRCSA-N |
| XLogP | 5.26 |
| TPSA | 67.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.98 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|