C29H33N3O4S — CID 69485812
(4aS,8aR)-4-(3,4-diethoxyphenyl)-2-[4-(thiomorpholine-4-carbonyl)phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 69485812) has the molecular formula C29H33N3O4S and a molecular weight of 519.67 g/mol. Its IUPAC name is (4aS,8aR)-4-(3,4-diethoxyphenyl)-2-[4-(thiomorpholine-4-carbonyl)phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | (4aS,8aR)-4-(3,4-diethoxyphenyl)-2-[4-(thiomorpholine-4-carbonyl)phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 69485812 |
| Molecular Formula | C29H33N3O4S |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | (4aS,8aR)-4-(3,4-diethoxyphenyl)-2-[4-(thiomorpholine-4-carbonyl)phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | CCOc1ccc(C2=NN(c3ccc(C(=O)N4CCSCC4)cc3)C(=O)[C@@H]3CC=CC[C@H]23)cc1OCC |
| InChI | InChI=1S/C29H33N3O4S/c1-3-35-25-14-11-21(19-26(25)36-4-2)27-23-7-5-6-8-24(23)29(34)32(30-27)22-12-9-20(10-13-22)28(33)31-15-17-37-18-16-31/h5-6,9-14,19,23-24H,3-4,7-8,15-18H2,1-2H3/t23-,24+/m0/s1 |
| InChIKey | FZLLROGAVXZKOE-BJKOFHAPSA-N |
| XLogP | 5.01 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|