C26H34N2O5 — CID 10983306
ethyl 2-[5-(3-cycloheptyl-4-oxo-4a,5,8,8a-tetrahydrophthalazin-1-yl)-2-methoxyphenoxy]acetate (PubChem CID 10983306) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is ethyl 2-[5-(3-cycloheptyl-4-oxo-4a,5,8,8a-tetrahydrophthalazin-1-yl)-2-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[5-(3-cycloheptyl-4-oxo-4a,5,8,8a-tetrahydrophthalazin-1-yl)-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 10983306 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | ethyl 2-[5-(3-cycloheptyl-4-oxo-4a,5,8,8a-tetrahydrophthalazin-1-yl)-2-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(C2=NN(C3CCCCCC3)C(=O)C3CC=CCC23)ccc1OC |
| InChI | InChI=1S/C26H34N2O5/c1-3-32-24(29)17-33-23-16-18(14-15-22(23)31-2)25-20-12-8-9-13-21(20)26(30)28(27-25)19-10-6-4-5-7-11-19/h8-9,14-16,19-21H,3-7,10-13,17H2,1-2H3 |
| InChIKey | UQZKHHAHSZXCLL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|