C27H37N5O5S — CID 87998576
4-[[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,8,8a-tetrahydrophthalazin-2-yl]piperidine-1-carbothioyl]amino]butylcarbamic acid (PubChem CID 87998576) has the molecular formula C27H37N5O5S and a molecular weight of 543.69 g/mol. Its IUPAC name is 4-[[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,8,8a-tetrahydrophthalazin-2-yl]piperidine-1-carbothioyl]amino]butylcarbamic acid.
| Compound Name | 4-[[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,8,8a-tetrahydrophthalazin-2-yl]piperidine-1-carbothioyl]amino]butylcarbamic acid |
|---|---|
| PubChem CID | 87998576 |
| Molecular Formula | C27H37N5O5S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | 4-[[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,8,8a-tetrahydrophthalazin-2-yl]piperidine-1-carbothioyl]amino]butylcarbamic acid |
| SMILES | COc1ccc(C2=NN(C3CCN(C(=S)NCCCCNC(=O)O)CC3)C(=O)[C@@H]3CC=CC[C@H]23)cc1OC |
| InChI | InChI=1S/C27H37N5O5S/c1-36-22-10-9-18(17-23(22)37-2)24-20-7-3-4-8-21(20)25(33)32(30-24)19-11-15-31(16-12-19)26(38)28-13-5-6-14-29-27(34)35/h3-4,9-10,17,19-21,29H,5-8,11-16H2,1-2H3,(H,28,38)(H,34,35)/t20-,21+/m0/s1 |
| InChIKey | IBUDGEDMZBSQBS-LEWJYISDSA-N |
| XLogP | 3.22 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|