C27H38N4O6 — CID 71118366
[(2R)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamic acid (PubChem CID 71118366) has the molecular formula C27H38N4O6 and a molecular weight of 514.62 g/mol. Its IUPAC name is [(2R)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamic acid.
| Compound Name | [(2R)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 71118366 |
| Molecular Formula | C27H38N4O6 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | [(2R)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamic acid |
| SMILES | COc1ccc(C2=NN(C3CCN(C(=O)[C@H](NC(=O)O)C(C)C)CC3)C(=O)[C@@H]3CCCC[C@H]23)cc1OC |
| InChI | InChI=1S/C27H38N4O6/c1-16(2)23(28-27(34)35)26(33)30-13-11-18(12-14-30)31-25(32)20-8-6-5-7-19(20)24(29-31)17-9-10-21(36-3)22(15-17)37-4/h9-10,15-16,18-20,23,28H,5-8,11-14H2,1-4H3,(H,34,35)/t19-,20+,23+/m0/s1 |
| InChIKey | YOWSHGOHYJWBEH-MIZPHKNDSA-N |
| XLogP | 3.34 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |