C24H35ClN4O4 — CID 71118433
(4aS,8aR)-2-[1-[(2R)-2-aminopropanoyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride (PubChem CID 71118433) has the molecular formula C24H35ClN4O4 and a molecular weight of 479.02 g/mol. Its IUPAC name is (4aS,8aR)-2-[1-[(2R)-2-aminopropanoyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride.
| Compound Name | (4aS,8aR)-2-[1-[(2R)-2-aminopropanoyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride |
|---|---|
| PubChem CID | 71118433 |
| Molecular Formula | C24H35ClN4O4 |
| Molecular Weight | 479.02 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | (4aS,8aR)-2-[1-[(2R)-2-aminopropanoyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride |
| SMILES | COc1ccc(C2=NN(C3CCN(C(=O)[C@@H](C)N)CC3)C(=O)[C@@H]3CCCC[C@H]23)cc1OC.Cl |
| InChI | InChI=1S/C24H34N4O4.ClH/c1-15(25)23(29)27-12-10-17(11-13-27)28-24(30)19-7-5-4-6-18(19)22(26-28)16-8-9-20(31-2)21(14-16)32-3;/h8-9,14-15,17-19H,4-7,10-13,25H2,1-3H3;1H/t15-,18+,19-;/m1./s1 |
| InChIKey | PGYNPZFXGPXGCH-KZXKMFFWSA-N |
| XLogP | 2.82 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.02 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |