C29H38ClN5O4 — CID 71118139
(4aS,8aR)-2-[1-[(2S)-2-amino-3-pyridin-4-ylpropanoyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride (PubChem CID 71118139) has the molecular formula C29H38ClN5O4 and a molecular weight of 556.11 g/mol. Its IUPAC name is (4aS,8aR)-2-[1-[(2S)-2-amino-3-pyridin-4-ylpropanoyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride.
| Compound Name | (4aS,8aR)-2-[1-[(2S)-2-amino-3-pyridin-4-ylpropanoyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride |
|---|---|
| PubChem CID | 71118139 |
| Molecular Formula | C29H38ClN5O4 |
| Molecular Weight | 556.11 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | (4aS,8aR)-2-[1-[(2S)-2-amino-3-pyridin-4-ylpropanoyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride |
| SMILES | COc1ccc(C2=NN(C3CCN(C(=O)[C@@H](N)Cc4ccncc4)CC3)C(=O)[C@@H]3CCCC[C@H]23)cc1OC.Cl |
| InChI | InChI=1S/C29H37N5O4.ClH/c1-37-25-8-7-20(18-26(25)38-2)27-22-5-3-4-6-23(22)28(35)34(32-27)21-11-15-33(16-12-21)29(36)24(30)17-19-9-13-31-14-10-19;/h7-10,13-14,18,21-24H,3-6,11-12,15-17,30H2,1-2H3;1H/t22-,23+,24-;/m0./s1 |
| InChIKey | AMPFQYDXQDWIDT-ZPMIJRNTSA-N |
| XLogP | 3.43 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.11 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |