C25H37ClN4O4 — CID 71117961
(4aS,8aR)-2-[1-[(2S)-2-aminobutanoyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride (PubChem CID 71117961) has the molecular formula C25H37ClN4O4 and a molecular weight of 493.05 g/mol. Its IUPAC name is (4aS,8aR)-2-[1-[(2S)-2-aminobutanoyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride.
| Compound Name | (4aS,8aR)-2-[1-[(2S)-2-aminobutanoyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride |
|---|---|
| PubChem CID | 71117961 |
| Molecular Formula | C25H37ClN4O4 |
| Molecular Weight | 493.05 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | (4aS,8aR)-2-[1-[(2S)-2-aminobutanoyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride |
| SMILES | CC[C@H](N)C(=O)N1CCC(N2N=C(c3ccc(OC)c(OC)c3)[C@H]3CCCC[C@H]3C2=O)CC1.Cl |
| InChI | InChI=1S/C25H36N4O4.ClH/c1-4-20(26)25(31)28-13-11-17(12-14-28)29-24(30)19-8-6-5-7-18(19)23(27-29)16-9-10-21(32-2)22(15-16)33-3;/h9-10,15,17-20H,4-8,11-14,26H2,1-3H3;1H/t18-,19+,20-;/m0./s1 |
| InChIKey | AEBIIKSCGIOPAT-NJBQKBHSSA-N |
| XLogP | 3.21 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.05 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |