C28H37ClN4O4S — CID 71118193
(4aS,8aR)-2-[1-[(2S)-2-amino-3-thiophen-2-ylpropanoyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride (PubChem CID 71118193) has the molecular formula C28H37ClN4O4S and a molecular weight of 561.15 g/mol. Its IUPAC name is (4aS,8aR)-2-[1-[(2S)-2-amino-3-thiophen-2-ylpropanoyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride.
| Compound Name | (4aS,8aR)-2-[1-[(2S)-2-amino-3-thiophen-2-ylpropanoyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride |
|---|---|
| PubChem CID | 71118193 |
| Molecular Formula | C28H37ClN4O4S |
| Molecular Weight | 561.15 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | (4aS,8aR)-2-[1-[(2S)-2-amino-3-thiophen-2-ylpropanoyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride |
| SMILES | COc1ccc(C2=NN(C3CCN(C(=O)[C@@H](N)Cc4cccs4)CC3)C(=O)[C@@H]3CCCC[C@H]23)cc1OC.Cl |
| InChI | InChI=1S/C28H36N4O4S.ClH/c1-35-24-10-9-18(16-25(24)36-2)26-21-7-3-4-8-22(21)27(33)32(30-26)19-11-13-31(14-12-19)28(34)23(29)17-20-6-5-15-37-20;/h5-6,9-10,15-16,19,21-23H,3-4,7-8,11-14,17,29H2,1-2H3;1H/t21-,22+,23-;/m0./s1 |
| InChIKey | RGZYFWYVYZKABK-SNXUGILLSA-N |
| XLogP | 4.10 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.15 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |