C27H39N5O6 — CID 71118748
[(2S)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-3-(dimethylamino)-1-oxopropan-2-yl]carbamic acid (PubChem CID 71118748) has the molecular formula C27H39N5O6 and a molecular weight of 529.64 g/mol. Its IUPAC name is [(2S)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-3-(dimethylamino)-1-oxopropan-2-yl]carbamic acid.
| Compound Name | [(2S)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-3-(dimethylamino)-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 71118748 |
| Molecular Formula | C27H39N5O6 |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.29 |
| IUPAC Name | [(2S)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-3-(dimethylamino)-1-oxopropan-2-yl]carbamic acid |
| SMILES | COc1ccc(C2=NN(C3CCN(C(=O)[C@H](CN(C)C)NC(=O)O)CC3)C(=O)[C@@H]3CCCC[C@H]23)cc1OC |
| InChI | InChI=1S/C27H39N5O6/c1-30(2)16-21(28-27(35)36)26(34)31-13-11-18(12-14-31)32-25(33)20-8-6-5-7-19(20)24(29-32)17-9-10-22(37-3)23(15-17)38-4/h9-10,15,18-21,28H,5-8,11-14,16H2,1-4H3,(H,35,36)/t19-,20+,21-/m0/s1 |
| InChIKey | QPGGWXWXZYQKQL-HBMCJLEFSA-N |
| XLogP | 2.25 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |