C35H52N4O6 — CID 86717204
tert-butyl N-[(2S)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-3-cyclohexyl-1-oxopropan-2-yl]carbamate (PubChem CID 86717204) has the molecular formula C35H52N4O6 and a molecular weight of 624.82 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-3-cyclohexyl-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-3-cyclohexyl-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 86717204 |
| Molecular Formula | C35H52N4O6 |
| Molecular Weight | 624.82 g/mol |
| Exact Mass | 624.39 |
| IUPAC Name | tert-butyl N-[(2S)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-3-cyclohexyl-1-oxopropan-2-yl]carbamate |
| SMILES | COc1ccc(C2=NN(C3CCN(C(=O)[C@H](CC4CCCCC4)NC(=O)OC(C)(C)C)CC3)C(=O)[C@@H]3CCCC[C@H]23)cc1OC |
| InChI | InChI=1S/C35H52N4O6/c1-35(2,3)45-34(42)36-28(21-23-11-7-6-8-12-23)33(41)38-19-17-25(18-20-38)39-32(40)27-14-10-9-13-26(27)31(37-39)24-15-16-29(43-4)30(22-24)44-5/h15-16,22-23,25-28H,6-14,17-21H2,1-5H3,(H,36,42)/t26-,27+,28-/m0/s1 |
| InChIKey | LVUQCSHQKJDXEV-IARZGTGTSA-N |
| XLogP | 5.91 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.82 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |