C32H44N6O6 — CID 86717216
tert-butyl N-[(2S)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 86717216) has the molecular formula C32H44N6O6 and a molecular weight of 608.74 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 86717216 |
| Molecular Formula | C32H44N6O6 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.33 |
| IUPAC Name | tert-butyl N-[(2S)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | COc1ccc(C2=NN(C3CCN(C(=O)[C@H](Cc4cnc[nH]4)NC(=O)OC(C)(C)C)CC3)C(=O)[C@@H]3CCCC[C@H]23)cc1OC |
| InChI | InChI=1S/C32H44N6O6/c1-32(2,3)44-31(41)35-25(17-21-18-33-19-34-21)30(40)37-14-12-22(13-15-37)38-29(39)24-9-7-6-8-23(24)28(36-38)20-10-11-26(42-4)27(16-20)43-5/h10-11,16,18-19,22-25H,6-9,12-15,17H2,1-5H3,(H,33,34)(H,35,41)/t23-,24+,25-/m0/s1 |
| InChIKey | GTPUENZVOQLNBY-GVAUOCQISA-N |
| XLogP | 3.91 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |