C38H49N5O6 — CID 86717220
tert-butyl N-[(2R)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-3-(1-methylindol-3-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 86717220) has the molecular formula C38H49N5O6 and a molecular weight of 671.84 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-3-(1-methylindol-3-yl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-3-(1-methylindol-3-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 86717220 |
| Molecular Formula | C38H49N5O6 |
| Molecular Weight | 671.84 g/mol |
| Exact Mass | 671.37 |
| IUPAC Name | tert-butyl N-[(2R)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-3-(1-methylindol-3-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | COc1ccc(C2=NN(C3CCN(C(=O)[C@@H](Cc4cn(C)c5ccccc45)NC(=O)OC(C)(C)C)CC3)C(=O)[C@@H]3CCCC[C@H]23)cc1OC |
| InChI | InChI=1S/C38H49N5O6/c1-38(2,3)49-37(46)39-30(21-25-23-41(4)31-14-10-9-11-27(25)31)36(45)42-19-17-26(18-20-42)43-35(44)29-13-8-7-12-28(29)34(40-43)24-15-16-32(47-5)33(22-24)48-6/h9-11,14-16,22-23,26,28-30H,7-8,12-13,17-21H2,1-6H3,(H,39,46)/t28-,29+,30+/m0/s1 |
| InChIKey | AAFQRKFAWUQCHM-FRXPANAUSA-N |
| XLogP | 5.68 |
| TPSA | 114.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.84 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |