C30H39ClN4O4 — CID 71118660
(4aS,8aR)-2-[1-[(2R)-2-amino-3-phenylpropanoyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride (PubChem CID 71118660) has the molecular formula C30H39ClN4O4 and a molecular weight of 555.12 g/mol. Its IUPAC name is (4aS,8aR)-2-[1-[(2R)-2-amino-3-phenylpropanoyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride.
| Compound Name | (4aS,8aR)-2-[1-[(2R)-2-amino-3-phenylpropanoyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride |
|---|---|
| PubChem CID | 71118660 |
| Molecular Formula | C30H39ClN4O4 |
| Molecular Weight | 555.12 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | (4aS,8aR)-2-[1-[(2R)-2-amino-3-phenylpropanoyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;hydrochloride |
| SMILES | COc1ccc(C2=NN(C3CCN(C(=O)[C@H](N)Cc4ccccc4)CC3)C(=O)[C@@H]3CCCC[C@H]23)cc1OC.Cl |
| InChI | InChI=1S/C30H38N4O4.ClH/c1-37-26-13-12-21(19-27(26)38-2)28-23-10-6-7-11-24(23)29(35)34(32-28)22-14-16-33(17-15-22)30(36)25(31)18-20-8-4-3-5-9-20;/h3-5,8-9,12-13,19,22-25H,6-7,10-11,14-18,31H2,1-2H3;1H/t23-,24+,25+;/m0./s1 |
| InChIKey | DHSOIRXRRCMXNA-UTXSYOJYSA-N |
| XLogP | 4.04 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.12 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |