C31H37F3N4O4 — CID 71118299
(4aS,8aR)-2-[1-[(2R)-2-amino-3-[4-(trifluoromethyl)phenyl]propanoyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one (PubChem CID 71118299) has the molecular formula C31H37F3N4O4 and a molecular weight of 586.66 g/mol. Its IUPAC name is (4aS,8aR)-2-[1-[(2R)-2-amino-3-[4-(trifluoromethyl)phenyl]propanoyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one.
| Compound Name | (4aS,8aR)-2-[1-[(2R)-2-amino-3-[4-(trifluoromethyl)phenyl]propanoyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one |
|---|---|
| PubChem CID | 71118299 |
| Molecular Formula | C31H37F3N4O4 |
| Molecular Weight | 586.66 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | (4aS,8aR)-2-[1-[(2R)-2-amino-3-[4-(trifluoromethyl)phenyl]propanoyl]piperidin-4-yl]-4-(3,4-dimethoxyphenyl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one |
| SMILES | COc1ccc(C2=NN(C3CCN(C(=O)[C@H](N)Cc4ccc(C(F)(F)F)cc4)CC3)C(=O)[C@@H]3CCCC[C@H]23)cc1OC |
| InChI | InChI=1S/C31H37F3N4O4/c1-41-26-12-9-20(18-27(26)42-2)28-23-5-3-4-6-24(23)29(39)38(36-28)22-13-15-37(16-14-22)30(40)25(35)17-19-7-10-21(11-8-19)31(32,33)34/h7-12,18,22-25H,3-6,13-17,35H2,1-2H3/t23-,24+,25+/m0/s1 |
| InChIKey | FICHPMHKYUMGNH-ISJGIBHGSA-N |
| XLogP | 4.64 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.66 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |