C31H38N4O6 — CID 71118512
[(2R)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-1-oxo-3-phenylpropan-2-yl]carbamic acid (PubChem CID 71118512) has the molecular formula C31H38N4O6 and a molecular weight of 562.67 g/mol. Its IUPAC name is [(2R)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-1-oxo-3-phenylpropan-2-yl]carbamic acid.
| Compound Name | [(2R)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-1-oxo-3-phenylpropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 71118512 |
| Molecular Formula | C31H38N4O6 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | [(2R)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-1-oxo-3-phenylpropan-2-yl]carbamic acid |
| SMILES | COc1ccc(C2=NN(C3CCN(C(=O)[C@@H](Cc4ccccc4)NC(=O)O)CC3)C(=O)[C@@H]3CCCC[C@H]23)cc1OC |
| InChI | InChI=1S/C31H38N4O6/c1-40-26-13-12-21(19-27(26)41-2)28-23-10-6-7-11-24(23)29(36)35(33-28)22-14-16-34(17-15-22)30(37)25(32-31(38)39)18-20-8-4-3-5-9-20/h3-5,8-9,12-13,19,22-25,32H,6-7,10-11,14-18H2,1-2H3,(H,38,39)/t23-,24+,25+/m0/s1 |
| InChIKey | NTHOXCOUNMIWHC-ISJGIBHGSA-N |
| XLogP | 3.93 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |