C36H48N4O6 — CID 86717175
tert-butyl N-[(2S)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-3-(3-methylphenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 86717175) has the molecular formula C36H48N4O6 and a molecular weight of 632.80 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-3-(3-methylphenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-3-(3-methylphenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 86717175 |
| Molecular Formula | C36H48N4O6 |
| Molecular Weight | 632.80 g/mol |
| Exact Mass | 632.36 |
| IUPAC Name | tert-butyl N-[(2S)-1-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,6,7,8,8a-hexahydrophthalazin-2-yl]piperidin-1-yl]-3-(3-methylphenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | COc1ccc(C2=NN(C3CCN(C(=O)[C@H](Cc4cccc(C)c4)NC(=O)OC(C)(C)C)CC3)C(=O)[C@@H]3CCCC[C@H]23)cc1OC |
| InChI | InChI=1S/C36H48N4O6/c1-23-10-9-11-24(20-23)21-29(37-35(43)46-36(2,3)4)34(42)39-18-16-26(17-19-39)40-33(41)28-13-8-7-12-27(28)32(38-40)25-14-15-30(44-5)31(22-25)45-6/h9-11,14-15,20,22,26-29H,7-8,12-13,16-19,21H2,1-6H3,(H,37,43)/t27-,28+,29-/m0/s1 |
| InChIKey | PJEDMBITTNMZPY-NHKHRBQYSA-N |
| XLogP | 5.49 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.80 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |