C26H35N3O7 — CID 70003824
(4aR,8aS)-4-(3,4-dimethoxyphenyl)-2-(1-methylpiperidin-4-yl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;(E)-but-2-enedioic acid (PubChem CID 70003824) has the molecular formula C26H35N3O7 and a molecular weight of 501.58 g/mol. Its IUPAC name is (4aR,8aS)-4-(3,4-dimethoxyphenyl)-2-(1-methylpiperidin-4-yl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;(E)-but-2-enedioic acid.
| Compound Name | (4aR,8aS)-4-(3,4-dimethoxyphenyl)-2-(1-methylpiperidin-4-yl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 70003824 |
| Molecular Formula | C26H35N3O7 |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | (4aR,8aS)-4-(3,4-dimethoxyphenyl)-2-(1-methylpiperidin-4-yl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one;(E)-but-2-enedioic acid |
| SMILES | COc1ccc(C2=NN(C3CCN(C)CC3)C(=O)[C@H]3CCCC[C@@H]23)cc1OC.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C22H31N3O3.C4H4O4/c1-24-12-10-16(11-13-24)25-22(26)18-7-5-4-6-17(18)21(23-25)15-8-9-19(27-2)20(14-15)28-3;5-3(6)1-2-4(7)8/h8-9,14,16-18H,4-7,10-13H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t17-,18+;/m1./s1 |
| InChIKey | HMBJHXRSEIXRFE-WPJKWKJRSA-N |
| XLogP | 2.86 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|