C26H34N4O6 — CID 11271957
2-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,8,8a-tetrahydrophthalazin-2-yl]piperidin-1-yl]-N-(2-methoxyethyl)-2-oxoacetamide (PubChem CID 11271957) has the molecular formula C26H34N4O6 and a molecular weight of 498.58 g/mol. Its IUPAC name is 2-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,8,8a-tetrahydrophthalazin-2-yl]piperidin-1-yl]-N-(2-methoxyethyl)-2-oxoacetamide.
| Compound Name | 2-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,8,8a-tetrahydrophthalazin-2-yl]piperidin-1-yl]-N-(2-methoxyethyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 11271957 |
| Molecular Formula | C26H34N4O6 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | 2-[4-[(4aS,8aR)-4-(3,4-dimethoxyphenyl)-1-oxo-4a,5,8,8a-tetrahydrophthalazin-2-yl]piperidin-1-yl]-N-(2-methoxyethyl)-2-oxoacetamide |
| SMILES | COCCNC(=O)C(=O)N1CCC(N2N=C(c3ccc(OC)c(OC)c3)[C@H]3CC=CC[C@H]3C2=O)CC1 |
| InChI | InChI=1S/C26H34N4O6/c1-34-15-12-27-24(31)26(33)29-13-10-18(11-14-29)30-25(32)20-7-5-4-6-19(20)23(28-30)17-8-9-21(35-2)22(16-17)36-3/h4-5,8-9,16,18-20H,6-7,10-15H2,1-3H3,(H,27,31)/t19-,20+/m0/s1 |
| InChIKey | QKHHPIJAVZQZDT-VQTJNVASSA-N |
| XLogP | 1.59 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|