C25H34N2O4 — CID 127041035
(4aS,8aR)-2-cycloheptyl-4-[4-methoxy-3-(2-methoxyethoxy)phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 127041035) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is (4aS,8aR)-2-cycloheptyl-4-[4-methoxy-3-(2-methoxyethoxy)phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | (4aS,8aR)-2-cycloheptyl-4-[4-methoxy-3-(2-methoxyethoxy)phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 127041035 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | (4aS,8aR)-2-cycloheptyl-4-[4-methoxy-3-(2-methoxyethoxy)phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | COCCOc1cc(C2=NN(C3CCCCCC3)C(=O)[C@@H]3CC=CC[C@H]23)ccc1OC |
| InChI | InChI=1S/C25H34N2O4/c1-29-15-16-31-23-17-18(13-14-22(23)30-2)24-20-11-7-8-12-21(20)25(28)27(26-24)19-9-5-3-4-6-10-19/h7-8,13-14,17,19-21H,3-6,9-12,15-16H2,1-2H3/t20-,21+/m0/s1 |
| InChIKey | VZBSYCDYSSJMAN-LEWJYISDSA-N |
| XLogP | 4.57 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|