C33H42N6O4 — CID 167312332
(4aS,8aR)-2-cycloheptyl-4-[4-methoxy-3-[4-[4-(2H-tetrazol-5-yl)phenoxy]butoxy]phenyl]-4a,5,6,7,8,8a-hexahydrophthalazin-1-one (PubChem CID 167312332) has the molecular formula C33H42N6O4 and a molecular weight of 586.74 g/mol. Its IUPAC name is (4aS,8aR)-2-cycloheptyl-4-[4-methoxy-3-[4-[4-(2H-tetrazol-5-yl)phenoxy]butoxy]phenyl]-4a,5,6,7,8,8a-hexahydrophthalazin-1-one.
| Compound Name | (4aS,8aR)-2-cycloheptyl-4-[4-methoxy-3-[4-[4-(2H-tetrazol-5-yl)phenoxy]butoxy]phenyl]-4a,5,6,7,8,8a-hexahydrophthalazin-1-one |
|---|---|
| PubChem CID | 167312332 |
| Molecular Formula | C33H42N6O4 |
| Molecular Weight | 586.74 g/mol |
| Exact Mass | 586.33 |
| IUPAC Name | (4aS,8aR)-2-cycloheptyl-4-[4-methoxy-3-[4-[4-(2H-tetrazol-5-yl)phenoxy]butoxy]phenyl]-4a,5,6,7,8,8a-hexahydrophthalazin-1-one |
| SMILES | COc1ccc(C2=NN(C3CCCCCC3)C(=O)[C@@H]3CCCC[C@H]23)cc1OCCCCOc1ccc(-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C33H42N6O4/c1-41-29-19-16-24(31-27-12-6-7-13-28(27)33(40)39(36-31)25-10-4-2-3-5-11-25)22-30(29)43-21-9-8-20-42-26-17-14-23(15-18-26)32-34-37-38-35-32/h14-19,22,25,27-28H,2-13,20-21H2,1H3,(H,34,35,37,38)/t27-,28+/m0/s1 |
| InChIKey | QMLXJEZJDQQLPP-WUFINQPMSA-N |
| XLogP | 6.19 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.74 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|