C33H42N2O3 — CID 101133937
(4aS,8aR)-2-cycloheptyl-4-[4-methoxy-3-(5-phenylpentoxy)phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 101133937) has the molecular formula C33H42N2O3 and a molecular weight of 514.71 g/mol. Its IUPAC name is (4aS,8aR)-2-cycloheptyl-4-[4-methoxy-3-(5-phenylpentoxy)phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | (4aS,8aR)-2-cycloheptyl-4-[4-methoxy-3-(5-phenylpentoxy)phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 101133937 |
| Molecular Formula | C33H42N2O3 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.32 |
| IUPAC Name | (4aS,8aR)-2-cycloheptyl-4-[4-methoxy-3-(5-phenylpentoxy)phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | COc1ccc(C2=NN(C3CCCCCC3)C(=O)[C@@H]3CC=CC[C@H]23)cc1OCCCCCc1ccccc1 |
| InChI | InChI=1S/C33H42N2O3/c1-37-30-22-21-26(24-31(30)38-23-13-5-8-16-25-14-6-4-7-15-25)32-28-19-11-12-20-29(28)33(36)35(34-32)27-17-9-2-3-10-18-27/h4,6-7,11-12,14-15,21-22,24,27-29H,2-3,5,8-10,13,16-20,23H2,1H3/t28-,29+/m0/s1 |
| InChIKey | OMBWXFIZADXIQW-URLMMPGGSA-N |
| XLogP | 7.34 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|