C23H30N2O4 — CID 20575762
(4aS,8aR)-4-(3,4-diethoxyphenyl)-2-(oxan-4-yl)-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 20575762) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is (4aS,8aR)-4-(3,4-diethoxyphenyl)-2-(oxan-4-yl)-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | (4aS,8aR)-4-(3,4-diethoxyphenyl)-2-(oxan-4-yl)-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 20575762 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | (4aS,8aR)-4-(3,4-diethoxyphenyl)-2-(oxan-4-yl)-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | CCOc1ccc(C2=NN(C3CCOCC3)C(=O)[C@@H]3CC=CC[C@H]23)cc1OCC |
| InChI | InChI=1S/C23H30N2O4/c1-3-28-20-10-9-16(15-21(20)29-4-2)22-18-7-5-6-8-19(18)23(26)25(24-22)17-11-13-27-14-12-17/h5-6,9-10,15,17-19H,3-4,7-8,11-14H2,1-2H3/t18-,19+/m0/s1 |
| InChIKey | XMKDIZMSFZAGDH-RBUKOAKNSA-N |
| XLogP | 3.79 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|