C24H35N3O5S — CID 11477107
4-(3,4-diethoxyphenyl)-2-(1-methylsulfonylpiperidin-4-yl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one (PubChem CID 11477107) has the molecular formula C24H35N3O5S and a molecular weight of 477.63 g/mol. Its IUPAC name is 4-(3,4-diethoxyphenyl)-2-(1-methylsulfonylpiperidin-4-yl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one.
| Compound Name | 4-(3,4-diethoxyphenyl)-2-(1-methylsulfonylpiperidin-4-yl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one |
|---|---|
| PubChem CID | 11477107 |
| Molecular Formula | C24H35N3O5S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 4-(3,4-diethoxyphenyl)-2-(1-methylsulfonylpiperidin-4-yl)-4a,5,6,7,8,8a-hexahydrophthalazin-1-one |
| SMILES | CCOc1ccc(C2=NN(C3CCN(S(C)(=O)=O)CC3)C(=O)C3CCCCC23)cc1OCC |
| InChI | InChI=1S/C24H35N3O5S/c1-4-31-21-11-10-17(16-22(21)32-5-2)23-19-8-6-7-9-20(19)24(28)27(25-23)18-12-14-26(15-13-18)33(3,29)30/h10-11,16,18-20H,4-9,12-15H2,1-3H3 |
| InChIKey | KLMYPRNKBQYNKZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 88.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |