C31H34ClN3O5 — CID 86601097
(4aS,8aR)-4-(3,4-dimethoxyphenyl)-2-[1-[(2-oxochromen-7-yl)methyl]piperidin-4-yl]-4a,5,8,8a-tetrahydrophthalazin-1-one;hydrochloride (PubChem CID 86601097) has the molecular formula C31H34ClN3O5 and a molecular weight of 564.08 g/mol. Its IUPAC name is (4aS,8aR)-4-(3,4-dimethoxyphenyl)-2-[1-[(2-oxochromen-7-yl)methyl]piperidin-4-yl]-4a,5,8,8a-tetrahydrophthalazin-1-one;hydrochloride.
| Compound Name | (4aS,8aR)-4-(3,4-dimethoxyphenyl)-2-[1-[(2-oxochromen-7-yl)methyl]piperidin-4-yl]-4a,5,8,8a-tetrahydrophthalazin-1-one;hydrochloride |
|---|---|
| PubChem CID | 86601097 |
| Molecular Formula | C31H34ClN3O5 |
| Molecular Weight | 564.08 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | (4aS,8aR)-4-(3,4-dimethoxyphenyl)-2-[1-[(2-oxochromen-7-yl)methyl]piperidin-4-yl]-4a,5,8,8a-tetrahydrophthalazin-1-one;hydrochloride |
| SMILES | COc1ccc(C2=NN(C3CCN(Cc4ccc5ccc(=O)oc5c4)CC3)C(=O)[C@@H]3CC=CC[C@H]23)cc1OC.Cl |
| InChI | InChI=1S/C31H33N3O5.ClH/c1-37-26-11-9-22(18-28(26)38-2)30-24-5-3-4-6-25(24)31(36)34(32-30)23-13-15-33(16-14-23)19-20-7-8-21-10-12-29(35)39-27(21)17-20;/h3-4,7-12,17-18,23-25H,5-6,13-16,19H2,1-2H3;1H/t24-,25+;/m0./s1 |
| InChIKey | QGNHRJRTWSANGJ-CLSOAGJSSA-N |
| XLogP | 5.03 |
| TPSA | 84.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.08 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|