C19H21N3O3S — CID 19357869
3-[(4-aminophenyl)methyl]-6-ethyl-5-(3-hydroxy-4-methoxyphenyl)-6H-1,3,4-thiadiazin-2-one (PubChem CID 19357869) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is 3-[(4-aminophenyl)methyl]-6-ethyl-5-(3-hydroxy-4-methoxyphenyl)-6H-1,3,4-thiadiazin-2-one.
| Compound Name | 3-[(4-aminophenyl)methyl]-6-ethyl-5-(3-hydroxy-4-methoxyphenyl)-6H-1,3,4-thiadiazin-2-one |
|---|---|
| PubChem CID | 19357869 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 3-[(4-aminophenyl)methyl]-6-ethyl-5-(3-hydroxy-4-methoxyphenyl)-6H-1,3,4-thiadiazin-2-one |
| SMILES | CCC1SC(=O)N(Cc2ccc(N)cc2)N=C1c1ccc(OC)c(O)c1 |
| InChI | InChI=1S/C19H21N3O3S/c1-3-17-18(13-6-9-16(25-2)15(23)10-13)21-22(19(24)26-17)11-12-4-7-14(20)8-5-12/h4-10,17,23H,3,11,20H2,1-2H3 |
| InChIKey | HNLAQXFYJRKUSS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|